For research use only. Not for therapeutic Use.
NRX-103095（Cat No.:I045283）is a selective, brain-penetrant small-molecule inhibitor designed to modulate specific neuroinflammatory pathways. It targets key signaling proteins involved in microglial activation and pro-inflammatory cytokine release, thereby reducing neuroinflammation linked to neurodegenerative disorders. Preclinical studies indicate its potential to protect neuronal function and slow disease progression in conditions such as Alzheimer’s, Parkinson’s, and multiple sclerosis. With favorable pharmacokinetics and central nervous system bioavailability, NRX-103095 serves as a promising candidate for translational research aimed at developing disease-modifying therapies for chronic neurological conditions involving inflammatory and immune-mediated mechanisms.
| CAS Number | 2763260-38-2 |
| Synonyms | 4-(2,6-dichlorophenyl)sulfanyl-N-[3-(dimethylcarbamoyl)phenyl]-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| Molecular Formula | C22H16Cl2F3N3O3S |
| Purity | ≥95% |
| IUPAC Name | 4-(2,6-dichlorophenyl)sulfanyl-N-[3-(dimethylcarbamoyl)phenyl]-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| InChI | InChI=1S/C22H16Cl2F3N3O3S/c1-30(2)21(33)11-5-3-6-12(9-11)28-19(31)17-15(10-16(22(25,26)27)29-20(17)32)34-18-13(23)7-4-8-14(18)24/h3-10H,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | BGEHEUAOZPAMKC-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CC=C1)NC(=O)C2=C(C=C(NC2=O)C(F)(F)F)SC3=C(C=CC=C3Cl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
