For research use only. Not for therapeutic Use.
Nrf2 Activator-4（Cat No.:I043690）is a small molecule designed to activate the Nrf2 (nuclear factor erythroid 2-related factor 2) pathway, which plays a pivotal role in cellular defense against oxidative stress and inflammation. By promoting Nrf2 activation, it enhances the expression of antioxidant enzymes and protective proteins, supporting the body’s natural defense mechanisms. Nrf2 Activator-4 is being studied for its therapeutic potential in treating diseases linked to oxidative stress, such as neurodegenerative disorders, cardiovascular diseases, and cancer. Its ability to boost cellular resilience makes it a promising candidate for novel therapeutic approaches.
| CAS Number | 2383016-68-8 |
| Synonyms | (E)-1-[4-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]phenyl]-3-[2-(trifluoromethyl)phenyl]prop-2-en-1-one;hydrochloride |
| Molecular Formula | C23H24ClF3N2O3 |
| Purity | ≥95% |
| IUPAC Name | (E)-1-[4-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]phenyl]-3-[2-(trifluoromethyl)phenyl]prop-2-en-1-one;hydrochloride |
| InChI | InChI=1S/C23H23F3N2O3.ClH/c1-27-12-14-28(15-13-27)22(30)16-31-19-9-6-18(7-10-19)21(29)11-8-17-4-2-3-5-20(17)23(24,25)26;/h2-11H,12-16H2,1H3;1H/b11-8+; |
| InChIKey | MLBFDNAGDZEBHA-YGCVIUNWSA-N |
| SMILES | CN1CCN(CC1)C(=O)COC2=CC=C(C=C2)C(=O)/C=C/C3=CC=CC=C3C(F)(F)F.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
