For research use only. Not for therapeutic Use.
Norswertianolin（Cat No.:I044924）is a naturally occurring xanthone compound isolated from medicinal plants such as Swertia and Gentiana species, commonly used in traditional Chinese and Ayurvedic medicine. It exhibits a range of pharmacological properties, including antioxidant, hepatoprotective, and anti-inflammatory effects. Norswertianolin is particularly noted for its role in liver protection and its potential to scavenge free radicals, making it valuable in treating liver disorders and oxidative stress-related diseases. Its xanthone core structure contributes to its biological activity and therapeutic promise in herbal formulations and modern pharmacological research focused on metabolic and inflammatory conditions.
| CAS Number | 54954-12-0 |
| Synonyms | 1,3,5-trihydroxy-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one |
| Molecular Formula | C19H18O11 |
| Purity | ≥95% |
| IUPAC Name | 1,3,5-trihydroxy-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one |
| InChI | InChI=1S/C19H18O11/c20-5-11-14(24)16(26)17(27)19(30-11)29-9-2-1-7(22)18-13(9)15(25)12-8(23)3-6(21)4-10(12)28-18/h1-4,11,14,16-17,19-24,26-27H,5H2/t11-,14-,16+,17-,19-/m1/s1 |
| InChIKey | MYWLBRTZOYHDOU-FJMCMGCSSA-N |
| SMILES | C1=CC(=C2C(=C1O)OC3=CC(=CC(=C3C2=O)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
