For research use only. Not for therapeutic Use.
NLRP3 agonist 1(CAT: I040558) is a selective small-molecule activator of the NLRP3 inflammasome, a key component of the innate immune system involved in the detection of cellular stress and pathogens. By promoting NLRP3 oligomerization and subsequent activation of caspase-1, this compound induces the maturation and release of pro-inflammatory cytokines such as IL-1β and IL-18. NLRP3 agonist 1 is a valuable tool for studying inflammasome biology, host-pathogen interactions, and inflammatory signaling pathways. It enables controlled activation of the NLRP3 complex in cellular and animal models, supporting research into autoinflammatory diseases, immunotherapies, and the development of inflammasome-targeted treatments.
| CAS Number | 2454019-69-1 |
| Synonyms | 4-N-(1-methylcyclopropyl)-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine |
| Molecular Formula | C15H16N6 |
| Purity | ≥95% |
| IUPAC Name | 4-N-(1-methylcyclopropyl)-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine |
| InChI | InChI=1S/C15H16N6/c1-15(5-6-15)20-13-10-3-2-9(11-4-7-17-21-11)8-12(10)18-14(16)19-13/h2-4,7-8H,5-6H2,1H3,(H,17,21)(H3,16,18,19,20) |
| InChIKey | KNPJIDCHCYGPIK-UHFFFAOYSA-N |
| SMILES | CC1(CC1)NC2=NC(=NC3=C2C=CC(=C3)C4=CC=NN4)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
