For research use only. Not for therapeutic Use.
NHI-2（Cat No.:I011176）is a synthetic inhibitor of lactate dehydrogenase A (LDHA), an enzyme critical for anaerobic glycolysis and a key player in the Warburg effect observed in cancer cells. By targeting LDHA, NHI-2 disrupts lactate production and energy metabolism in tumor cells, leading to reduced proliferation and enhanced apoptosis. It is a valuable tool in cancer metabolism research, particularly for studying hypoxia-driven and glycolysis-dependent tumor growth. NHI-2 has shown promise in preclinical models, making it a potential lead compound for developing novel anticancer therapies targeting metabolic vulnerabilities.
| CAS Number | 1269802-97-2 |
| Synonyms | methyl 1-hydroxy-6-phenyl-4-(trifluoromethyl)indole-2-carboxylate |
| Molecular Formula | C17H12F3NO3 |
| Purity | ≥95% |
| IUPAC Name | methyl 1-hydroxy-6-phenyl-4-(trifluoromethyl)indole-2-carboxylate |
| InChI | InChI=1S/C17H12F3NO3/c1-24-16(22)15-9-12-13(17(18,19)20)7-11(8-14(12)21(15)23)10-5-3-2-4-6-10/h2-9,23H,1H3 |
| InChIKey | YPPFWRWCZNXINO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C(C=C2N1O)C3=CC=CC=C3)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
