For research use only. Not for therapeutic Use.
NHE3-IN-2（Cat No.:I044422）is a potent and selective inhibitor of sodium/hydrogen exchanger 3 (NHE3), a membrane transporter primarily expressed in the kidney and intestine that regulates sodium absorption and acid-base balance. By blocking NHE3 activity, NHE3-IN-2 reduces sodium reabsorption and enhances fluid excretion, offering therapeutic potential in conditions such as hypertension, chronic kidney disease, and heart failure. It also modulates intestinal sodium and phosphate handling, making it useful in metabolic and gastrointestinal research. NHE3-IN-2 is a valuable tool for studying electrolyte transport and developing novel diuretic or natriuretic therapies.
| CAS Number | 92434-13-4 |
| Synonyms | 2-(6-chloro-4-phenylquinazolin-2-yl)guanidine |
| Molecular Formula | C15H12ClN5 |
| Purity | ≥95% |
| IUPAC Name | 2-(6-chloro-4-phenylquinazolin-2-yl)guanidine |
| InChI | InChI=1S/C15H12ClN5/c16-10-6-7-12-11(8-10)13(9-4-2-1-3-5-9)20-15(19-12)21-14(17)18/h1-8H,(H4,17,18,19,20,21) |
| InChIKey | RGJFEUSQLIFRJG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC3=C2C=C(C=C3)Cl)N=C(N)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
