For research use only. Not for therapeutic Use.
NHC-diphosphate(Cat No.:I044510)is a phosphorylated metabolite of N-hydroxycytidine (NHC), the active antiviral agent derived from molnupiravir. As an intermediate in the activation pathway, NHC-diphosphate is further phosphorylated to the triphosphate form, which is incorporated into viral RNA by RNA-dependent RNA polymerases. This incorporation induces error-prone replication and lethal mutagenesis, effectively inhibiting RNA virus propagation. NHC-diphosphate is critical for studying the enzymatic activation and intracellular metabolism of nucleoside analogs. It is widely used in biochemical and antiviral research to understand nucleotide processing and support the development of broad-spectrum antiviral therapeutics.
| CAS Number | 39023-73-9 |
| Synonyms | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl phosphono hydrogen phosphate |
| Molecular Formula | C9H15N3O12P2 |
| Purity | ≥95% |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl phosphono hydrogen phosphate |
| InChI | InChI=1S/C9H15N3O12P2/c13-6-4(3-22-26(20,21)24-25(17,18)19)23-8(7(6)14)12-2-1-5(11-16)10-9(12)15/h1-2,4,6-8,13-14,16H,3H2,(H,20,21)(H,10,11,15)(H2,17,18,19)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | LCSZLCQPBIHOHF-XVFCMESISA-N |
| SMILES | C1=CN(C(=O)N=C1NO)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)(O)OP(=O)(O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |