For research use only. Not for therapeutic Use.
NADPH oxidase-IN-1(Cat No.:I042454)is a small molecule inhibitor that targets NADPH oxidase, an enzyme complex responsible for producing reactive oxygen species (ROS) during immune responses. By inhibiting NADPH oxidase, this compound reduces oxidative stress and inflammation, which are implicated in various chronic diseases, including cardiovascular diseases, neurodegenerative disorders, and autoimmune conditions. NADPH oxidase-IN-1 is being investigated for its potential to treat diseases where excessive ROS production contributes to tissue damage and inflammation. This inhibitor offers a novel approach to modulate oxidative stress and provide therapeutic benefits in related disease settings.
| CAS Number | 2762405-17-2 |
| Synonyms | (5E)-3-cyclohexyl-5-[[4-[2-hydroxyethyl(methyl)amino]phenyl]methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one |
| Molecular Formula | C20H27N3O2S |
| Purity | ≥95% |
| IUPAC Name | (5E)-3-cyclohexyl-5-[[4-[2-hydroxyethyl(methyl)amino]phenyl]methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one |
| InChI | InChI=1S/C20H27N3O2S/c1-21(12-13-24)16-10-8-15(9-11-16)14-18-19(25)23(20(26)22(18)2)17-6-4-3-5-7-17/h8-11,14,17,24H,3-7,12-13H2,1-2H3/b18-14+ |
| InChIKey | ZRIXYNJXSCQFPE-NBVRZTHBSA-N |
| SMILES | CN1/C(=C/C2=CC=C(C=C2)N(C)CCO)/C(=O)N(C1=S)C3CCCCC3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |