For research use only. Not for therapeutic Use.
N-Succinimidyl 3-(Bromoacetamido)propionate（Cat No.:R000689）, is a versatile chemical used as a linker in PROTAC and antibody-drug conjugate (ADC) synthesis. As a PROTAC linker, it facilitates the creation of bifunctional molecules that target specific proteins for degradation. Additionally, it serves as a cleavable ADC linker, connecting therapeutic drugs to antibodies for targeted delivery. N-Succinimidyl 3-(Bromoacetamido)propionate belongs to the PEG class and plays a crucial role in the development of innovative therapies, enabling targeted protein degradation and selective drug delivery.
| Catalog Number | R000689 |
| CAS Number | 57159-62-3 |
| Synonyms | 2-Bromo-N-[3-[(2,5-dioxo-1-pyrrolidinyl)oxy]-3-oxopropyl]acetamide; SBAP; |
| Molecular Formula | C9H11BrN2O5 |
| Purity | ≥95% |
| Target | Antibody-drug Conjugate/ADC Related |
| Storage | Store at -20°C |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[(2-bromoacetyl)amino]propanoate |
| InChI | InChI=1S/C9H11BrN2O5/c10-5-6(13)11-4-3-9(16)17-12-7(14)1-2-8(12)15/h1-5H2,(H,11,13) |
| InChIKey | WGMMKWFUXPMTRW-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCNC(=O)CBr |
