For research use only. Not for therapeutic Use.
N-Piperidine Ibrutinib hydrochloride（Cat No.:I015519）is a structurally modified derivative of ibrutinib, a first-in-class, covalent inhibitor of Bruton’s tyrosine kinase (BTK). Incorporating an N-piperidine moiety, this analog offers a functional handle for conjugation, probe development, or medicinal chemistry optimization. Like ibrutinib, it targets BTK to disrupt B-cell receptor signaling, impairing survival and proliferation of malignant B cells. Supplied as the hydrochloride salt, it ensures solubility and stability. N-Piperidine Ibrutinib hydrochloride is mainly applied in cancer research, chemical biology, and targeted therapy development, particularly in lymphoid malignancies.
| CAS Number | 2231747-18-3 |
| Synonyms | 3-(4-phenoxyphenyl)-1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine;hydrochloride |
| Molecular Formula | C22H23ClN6O |
| Purity | ≥95% |
| IUPAC Name | 3-(4-phenoxyphenyl)-1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine;hydrochloride |
| InChI | InChI=1S/C22H22N6O.ClH/c23-21-19-20(15-6-8-18(9-7-15)29-17-4-2-1-3-5-17)27-28(22(19)26-14-25-21)16-10-12-24-13-11-16;/h1-9,14,16,24H,10-13H2,(H2,23,25,26);1H |
| InChIKey | ORBFZIXZKIUECG-UHFFFAOYSA-N |
| SMILES | C1CNCCC1N2C3=NC=NC(=C3C(=N2)C4=CC=C(C=C4)OC5=CC=CC=C5)N.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
