For research use only. Not for therapeutic Use.
N-(Hydroxymethyl)nicotinamide(Cat No.:R000131), is a chemical compound that belongs to the class of nicotinamide derivatives. It is also known as nicotinic alcohol or 1-(hydroxymethyl)pyridinium-3-carboxamide. N-(Hydroxymethyl)nicotinamide is a key intermediate in the synthesis of nicotinamide adenine dinucleotide (NAD), an essential coenzyme involved in various metabolic processes in living organisms. Additionally, this compound has shown potential in medical and pharmaceutical research, where it is used in the synthesis of various pharmaceutical agents and as a precursor for other biologically active compounds.
| CAS Number | 3569-99-1 |
| Synonyms | N-(Hydroxymethyl)-3-pyridinecarboxamide; 3-Pyridinecarboxylic acid hydroxymethylamide; Bilamid; Bilizorin; Bilocid; Biloide; Biobilan; C 1094; Cholamid; Cholamide; Nicodin; Nicodine; Nicoform; Nicometamide; Nifoform; Nikodin; Nikoform; Nikomethamide; |
| Molecular Formula | C7H8N2O2 |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | RT |
| IUPAC Name | N-(hydroxymethyl)pyridine-3-carboxamide |
| InChI | InChI=1S/C7H8N2O2/c10-5-9-7(11)6-2-1-3-8-4-6/h1-4,10H,5H2,(H,9,11) |
| InChIKey | JRFKIOFLCXKVOT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)NCO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |