For research use only. Not for therapeutic Use.
| CAS Number | 3705-42-8 |
| Synonyms | N-[(Phenylmethoxy)carbonyl]-L-glutamic Acid 1-(Phenylmethyl)ester; N-(Benzyloxycarbonyl)-L-glutamic Acid α-Benzyl Ester; N-Benzyloxycarbonyl-L-glutamic Acid 1-Benzyl Ester; NSC 169160; α-Benzyl N-(benzyloxycarbonyl)-L-glutamate; ?? |
| Molecular Formula | C20H21NO6 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (4S)-5-oxo-5-phenylmethoxy-4-(phenylmethoxycarbonylamino)pentanoic acid |
| InChI | InChI=1S/C20H21NO6/c22-18(23)12-11-17(19(24)26-13-15-7-3-1-4-8-15)21-20(25)27-14-16-9-5-2-6-10-16/h1-10,17H,11-14H2,(H,21,25)(H,22,23)/t17-/m0/s1 |
| InChIKey | VWHKODOUMSMUAF-KRWDZBQOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C(CCC(=O)O)NC(=O)OCC2=CC=CC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |