N-Carbethoxyphthalimide - CAS 22509-74-6

N-Carbethoxyphthalimide(Cat No.:R027787), is a chemical compound used in organic synthesis and as a reagent in various chemical reactions. It is a phthalimide derivative with a carb ethoxy (ethyl ester) group attached to the nitrogen atom. N-Carbethoxyphthalimide is commonly employed as a source of the N-acyliminium ion, a reactive intermediate in organic chemistry. It participates in reactions like the N-acyliminium ion cyclization and various N-alkylation processes, making it a valuable building block in the synthesis of diverse organic compounds and pharmaceutical intermediates.

Catalog Number: R027787

CAS Number: 22509-74-6

PubChem Substance ID:355186608

Molecular Formula: C11H9NO4

Molecular Weight:219.19

Purity: ≥95%

* For research use only. Not for human or veterinary use.

Synonym

Synonyms,3-Dioxo-1,3-dihydroisoindole-2-carboxylic acid ethyl ester; 2-(Carbethoxy)phthalimide; Carbethoxyphthalimide; Ethyl 1,3-dioxo-1,3-dihydro-2H-isoindole-2-carboxylate; Ethyl 1,3-dioxo-1,3-dihydroisoindole-2-carboxylate; Ethyl 1,3-dioxo-2,3-dihydro-1H-

Property

Molecular Formula: C11H9NO4
Molecular Weight219.19
Purity≥95%
Storage2-8°C

Computed Descriptor

IUPAC Nameethyl 1,3-dioxoisoindole-2-carboxylate
InChIInChI=1S/C11H9NO4/c1-2-16-11(15)12-9(13)7-5-3-4-6-8(7)10(12)14/h3-6H,2H2,1H3
InChIKeyVRHAQNTWKSVEEC-UHFFFAOYSA-N
SMILESCCOC(=O)N1C(=O)C2=CC=CC=C2C1=O