For research use only. Not for therapeutic Use.
N-Benzylhexadecanamide(Cat No.:R054797)is a long-chain fatty acid amide with applications in biochemical and pharmaceutical research, particularly in studies involving the endocannabinoid system. Structurally similar to endogenous fatty acid amides, it interacts with cannabinoid receptors, making it useful for studying receptor signaling pathways and potential therapeutic effects. N-Benzylhexadecanamide’s lipid-based structure also aids in exploring cell membrane dynamics and signaling processes. Its versatility in mimicking biological lipids allows researchers to investigate its role in inflammation, pain modulation, and neurological studies, contributing to advancements in cannabinoid-related drug development.
| CAS Number | 74058-71-2 |
| Synonyms | N-(phenylmethyl)-hexadecanamide |
| Molecular Formula | C23H39NO |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | N-benzylhexadecanamide |
| InChI | InChI=1S/C23H39NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-20-23(25)24-21-22-18-15-14-16-19-22/h14-16,18-19H,2-13,17,20-21H2,1H3,(H,24,25) |
| InChIKey | MLGPKWUKOQAAGI-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCCCCCC(=O)NCC1=CC=CC=C1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |