For research use only. Not for therapeutic Use.
MTR-106(Cat No.:I038795)is an investigational small molecule drug being developed for the treatment of various cancers. It is designed to target and inhibit specific molecular pathways involved in tumor cell proliferation, survival, and metastasis. By disrupting these pathways, MTR-106 aims to reduce the growth of cancer cells and enhance their susceptibility to other treatments, potentially overcoming resistance to conventional therapies. Preclinical studies have shown encouraging results, and ongoing clinical trials are evaluating its safety, efficacy, and potential as a therapeutic option for patients with solid tumors and hematologic malignancies.
| CAS Number | 1639357-93-9 |
| Synonyms | 2-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-N-[(5-methylpyrazin-2-yl)methyl]-5-oxo-[1,3]benzothiazolo[3,2-a][1,8]naphthyridine-6-carboxamide |
| Molecular Formula | C28H27N7O2S |
| Purity | ≥95% |
| IUPAC Name | 2-[(3aR,6aS)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-N-[(5-methylpyrazin-2-yl)methyl]-5-oxo-[1,3]benzothiazolo[3,2-a][1,8]naphthyridine-6-carboxamide |
| InChI | InChI=1S/C29H28N6O2S/c1-16-11-31-20(12-30-16)13-32-28(37)25-26(36)21-7-8-22(17-9-18-14-34(2)15-19(18)10-17)33-27(21)35-23-5-3-4-6-24(23)38-29(25)35/h3-8,11-12,17-19H,9-10,13-15H2,1-2H3,(H,32,37)/t17?,18-,19+ |
| InChIKey | ZAOCPDXRBFOCQL-YQQQUEKLSA-N |
| SMILES | CC1=CN=C(C=N1)CNC(=O)C2=C3N(C4=CC=CC=C4S3)C5=C(C2=O)C=CC(=N5)C6C[C@@H]7CN(C[C@@H]7C6)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |