For research use only. Not for therapeutic Use.
MS117（Cat No.:I045829）is a potent, selective chemical degrader of the histone methyltransferase DOT1L, an enzyme that catalyzes methylation of histone H3 lysine 79 (H3K79) and regulates gene expression. By promoting targeted DOT1L degradation, MS117 effectively suppresses aberrant transcriptional programs driven by mixed-lineage leukemia (MLL) rearrangements, making it highly valuable in cancer research. Unlike classical inhibitors, it provides sustained target suppression through proteolysis-targeting chimera (PROTAC) technology. MS117 serves as a versatile tool for studying epigenetic regulation, transcriptional control, and therapeutic strategies in oncology and epigenetics-driven diseases.
| CAS Number | 2702280-86-0 |
| Synonyms | N-[3-[4-[[2-aminoethyl(methyl)amino]methyl]-1H-pyrrol-3-yl]phenyl]prop-2-enamide |
| Molecular Formula | C17H22N4O |
| Purity | ≥95% |
| IUPAC Name | N-[3-[4-[[2-aminoethyl(methyl)amino]methyl]-1H-pyrrol-3-yl]phenyl]prop-2-enamide |
| InChI | InChI=1S/C17H22N4O/c1-3-17(22)20-15-6-4-5-13(9-15)16-11-19-10-14(16)12-21(2)8-7-18/h3-6,9-11,19H,1,7-8,12,18H2,2H3,(H,20,22) |
| InChIKey | HVDMIAFOVVMNJF-UHFFFAOYSA-N |
| SMILES | CN(CCN)CC1=CNC=C1C2=CC(=CC=C2)NC(=O)C=C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
