For research use only. Not for therapeutic Use.
MOC-Val-OH (Cat No.:I043046) is a protected form of the amino acid valine, commonly used in peptide synthesis. The MOC (4-methyl-2-oxazolyl) group provides a stable, removable protection for the amino group of valine, preventing unwanted reactions during peptide chain elongation. Once the peptide synthesis is complete, the MOC group can be selectively removed using mild acidic conditions, allowing for the efficient formation of the final peptide. MOC-Val-OH is widely used in both solid-phase and solution-phase peptide synthesis for the production of bioactive peptides and pharmaceutical compounds.
| CAS Number | 74761-42-5 |
| Synonyms | (2S)-2-(methoxycarbonylamino)-3-methylbutanoic acid |
| Molecular Formula | C7H13NO4 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-(methoxycarbonylamino)-3-methylbutanoic acid |
| InChI | InChI=1S/C7H13NO4/c1-4(2)5(6(9)10)8-7(11)12-3/h4-5H,1-3H3,(H,8,11)(H,9,10)/t5-/m0/s1 |
| InChIKey | CEFVHPDFGLDQKU-YFKPBYRVSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |