For research use only. Not for therapeutic Use.
MMG-11(CAT: I019481) is a selective inhibitor of heat shock protein 90 (Hsp90), a molecular chaperone essential for the stability and function of various client proteins involved in cellular signaling, proliferation, and survival. By binding to the ATP-binding domain of Hsp90, MMG-11 disrupts its chaperone activity, leading to the degradation of client proteins and the inhibition of oncogenic pathways. This mechanism makes MMG-11 a valuable tool in cancer research, particularly for studying the role of Hsp90 in tumor progression, metastasis, and drug resistance. MMG-11 holds potential for the development of targeted therapies against Hsp90-dependent cancers.
| CAS Number | 313254-94-3 |
| Molecular Formula | C₁₅H₁₄O₇ |
| Purity | ≥95% |
| Target | Toll-like Receptor (TLR) |
| IUPAC Name | ethyl 5-[2-oxo-2-(2,3,4-trihydroxyphenyl)ethyl]furan-2-carboxylate |
| InChI | InChI=1S/C15H14O7/c1-2-21-15(20)12-6-3-8(22-12)7-11(17)9-4-5-10(16)14(19)13(9)18/h3-6,16,18-19H,2,7H2,1H3 |
| InChIKey | IIDUJWIVMGALOG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(O1)CC(=O)C2=C(C(=C(C=C2)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |