For research use only. Not for therapeutic Use.
MM-206（Cat No.:R067084）is a novel small molecule compound being investigated for its potential therapeutic applications in treating autoimmune diseases and cancer. It functions by selectively inhibiting specific signaling pathways involved in immune cell activation and tumor progression. By targeting these pathways, MM-206 has shown promise in modulating immune responses and suppressing tumor growth. In preclinical studies, the compound has demonstrated its ability to regulate immune cell activity, making it a valuable candidate for developing targeted therapies for conditions such as autoimmune disorders and certain cancers. Further studies are required to evaluate its safety and efficacy.
| CAS Number | 1809581-87-0 |
| Synonyms | 2,3,4,5,6-pentafluoro-N-(4-hydroxy-3-phenylsulfanylnaphthalen-1-yl)benzenesulfonamide |
| Molecular Formula | C22H12F5NO3S2 |
| Purity | ≥95% |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(4-hydroxy-3-phenylsulfanylnaphthalen-1-yl)benzenesulfonamide |
| InChI | InChI=1S/C22H12F5NO3S2/c23-16-17(24)19(26)22(20(27)18(16)25)33(30,31)28-14-10-15(32-11-6-2-1-3-7-11)21(29)13-9-5-4-8-12(13)14/h1-10,28-29H |
| InChIKey | ZXJHEANDHXHGMV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=C(C3=CC=CC=C3C(=C2)NS(=O)(=O)C4=C(C(=C(C(=C4F)F)F)F)F)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
