For research use only. Not for therapeutic Use.
MLS001006105（Cat No.:I043744）is a small molecule compound identified through high-throughput screening, primarily studied for its potential as an anti-cancer agent. It works by targeting specific enzymes or pathways involved in cell survival, proliferation, and metastasis. MLS001006105 has shown promise in preclinical studies for inhibiting tumor cell growth and disrupting critical molecular processes associated with cancer progression. The compound is being investigated for its ability to selectively target and modulate specific cellular mechanisms, offering a potential strategy for targeted cancer therapies. Further studies are needed to assess its therapeutic potential and safety for clinical use.
| CAS Number | 455310-36-8 |
| Synonyms | N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
| Molecular Formula | C15H15N5O3S2 |
| Purity | ≥95% |
| IUPAC Name | N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
| InChI | InChI=1S/C15H15N5O3S2/c1-22-11-4-3-9(5-12(11)23-2)10-6-24-15(18-10)19-13(21)7-25-14-16-8-17-20-14/h3-6,8H,7H2,1-2H3,(H,16,17,20)(H,18,19,21) |
| InChIKey | MOJJOJXUACHANH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CSC(=N2)NC(=O)CSC3=NC=NN3)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
