DOI hydrochloride (Cat.No:I010596) is a selective serotonin receptor agonist primarily used in scientific research. It specifically targets the 5-HT2A receptor, mimicking the effects of serotonin in the brain. DOI hydrochloride is utilized to study the role of serotonin receptors in various neurological and psychiatric conditions.
Catalog Number | I010596 |
CAS Number | 42203-78-1 |
Synonyms | Alternative Name: (±)-2,5-Dimethoxy-4-iodoamphetamine hydrochloride |
Molecular Formula | C11H17ClINO2 |
Purity | 95% |
Target | 5-HT Receptor |
Solubility | Soluble to 50 mM in water |
Storage | Store at RT |
IUPAC Name | 1-(4-iodo-2,5-dimethoxyphenyl)propan-2-amine;hydrochloride |
InChI | InChI=1S/C11H16INO2.ClH/c1-7(13)4-8-5-11(15-3)9(12)6-10(8)14-2;/h5-7H,4,13H2,1-3H3;1H |
InChIKey | QVFDMWGKHUFODK-UHFFFAOYSA-N |
SMILES | CC(CC1=CC(=C(C=C1OC)I)OC)N.Cl |