For research use only. Not for therapeutic Use.
MLS000544460（Cat No.:I015508）is a small-molecule research probe from the Molecular Libraries Small Molecule Repository (MLSMR), developed through NIH chemical genomics initiatives. Identified in high-throughput screening, it functions as a modulator of phosphatidylinositol signaling pathways, with reported activity against phosphatidylinositol synthase (PIS). By interfering with PIS-mediated phospholipid biosynthesis, MLS000544460 impacts membrane trafficking, autophagy, and cellular energy regulation. Researchers use it to explore lipid metabolism, protein–lipid interactions, and potential therapeutic mechanisms in cancer, metabolic disorders, and neurodegeneration. It serves as a versatile chemical tool in chemical biology and drug discovery.
| CAS Number | 352336-36-8 |
| Synonyms | 3-fluoro-N-[(E)-(5-pyridin-2-ylsulfanylfuran-2-yl)methylideneamino]benzamide |
| Molecular Formula | C17H12FN3O2S |
| Purity | ≥95% |
| IUPAC Name | 3-fluoro-N-[(E)-(5-pyridin-2-ylsulfanylfuran-2-yl)methylideneamino]benzamide |
| InChI | InChI=1S/C17H12FN3O2S/c18-13-5-3-4-12(10-13)17(22)21-20-11-14-7-8-16(23-14)24-15-6-1-2-9-19-15/h1-11H,(H,21,22)/b20-11+ |
| InChIKey | VDKNIVFIPSLUFD-RGVLZGJSSA-N |
| SMILES | C1=CC=NC(=C1)SC2=CC=C(O2)/C=N/NC(=O)C3=CC(=CC=C3)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
