For research use only. Not for therapeutic Use.
Mitomycin C(CAT: A000102) is an antibiotic with potent antineoplastic (anticancer) properties, commonly used in cancer chemotherapy. It functions as an alkylating agent, cross-linking DNA strands and inhibiting DNA synthesis, which leads to cell death. Mitomycin C is particularly effective against hypoxic tumor cells and is used to treat various cancers, including bladder cancer, gastric cancer, and pancreatic cancer. It is also used as a topical agent in ophthalmology to prevent scarring during glaucoma surgery. While highly effective, Mitomycin C can cause significant side effects, including bone marrow suppression, gastrointestinal disturbances, and potential kidney or lung toxicity. Its application is usually reserved for carefully monitored chemotherapy regimens.
| CAS Number | 50-07-7 |
| Synonyms | mitomycin C; Mitomycin; Mutamycin; Ametycine |
| Molecular Formula | C15H18N4O5 |
| Purity | ≥95% |
| Target | Apoptosis Inducers |
| Solubility | 16.7mg/mL in DMSO |
| Storage | Store at 4°C |
| IUPAC Name | [(4S,6S,7R,8S)-11-amino-7-methoxy-12-methyl-10,13-dioxo-2,5-diazatetracyclo[7.4.0.02,7.04,6]trideca-1(9),11-dien-8-yl]methyl carbamate |
| InChI | InChI=1S/C15H18N4O5/c1-5-9(16)12(21)8-6(4-24-14(17)22)15(23-2)13-7(18-13)3-19(15)10(8)11(5)20/h6-7,13,18H,3-4,16H2,1-2H3,(H2,17,22)/t6-,7+,13+,15-/m1/s1 |
| InChIKey | NWIBSHFKIJFRCO-WUDYKRTCSA-N |
| SMILES | CC1=C(C(=O)C2=C(C1=O)N3CC4C(C3(C2COC(=O)N)OC)N4)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
