For research use only. Not for therapeutic Use.
MGCD0103 (Cat No.:I004705) is a small-molecule inhibitor that targets histone deacetylases (HDACs). HDACs are enzymes involved in the regulation of gene expression by removing acetyl groups from histone proteins, leading to chromatin compaction and gene silencing. MGCD0103 specifically inhibits HDAC1, HDAC2, and HDAC3 isoforms, resulting in the accumulation of acetyl groups on histones and the activation of gene transcription. This compound has shown potential as an anticancer agent, particularly in hematological malignancies and solid tumors. MGCD0103 is being investigated for its ability to induce cell cycle arrest, promote apoptosis, and inhibit tumor growth. It represents a promising therapeutic option in the field of epigenetic cancer therapy.
| CAS Number | 726169-73-9 |
| Synonyms | Mocetinostat; MGCD-0103; N-(2-aminophenyl)-4-[[(4-pyridin-3-ylpyrimidin-2-yl)amino]methyl]benzamide |
| Molecular Formula | C₂₃H₂₀N₆O |
| Purity | ≥95% |
| Target | Epigenetics |
| Solubility | Soluble in DMSO, not in water |
| Storage | -20°C |
| Overview of Clinical Research | Originator: MethylGene<br /> |
| IC50 | 0.15 μM(HDAC 1); 0.29 μM(HDAC 2); 1.66 μM(HDAC 3) |
| IUPAC Name | N-(2-aminophenyl)-4-[[(4-pyridin-3-ylpyrimidin-2-yl)amino]methyl]benzamide |
| InChI | InChI=1S/C23H20N6O/c24-19-5-1-2-6-21(19)28-22(30)17-9-7-16(8-10-17)14-27-23-26-13-11-20(29-23)18-4-3-12-25-15-18/h1-13,15H,14,24H2,(H,28,30)(H,26,27,29) |
| InChIKey | HRNLUBSXIHFDHP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)NC(=O)C2=CC=C(C=C2)CNC3=NC=CC(=N3)C4=CN=CC=C4 |
| Reference | 1. Curr Opin Investig Drugs. 2007 Jun;8(6):485-92. |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |