Metformin(Cat No.:R039773)is a widely used oral medication for managing type 2 diabetes. It works by decreasing hepatic glucose production, enhancing insulin sensitivity, and improving peripheral glucose uptake, thereby lowering blood sugar levels. Metformin is often the first-line treatment due to its efficacy, safety profile, and benefits in weight management. Additionally, it has been associated with cardiovascular protection and potential anti-aging effects. Its role in reducing the risk of diabetes complications makes it a cornerstone therapy in diabetes management, contributing significantly to improved patient outcomes and quality of life.
Catalog Number | R039773 |
CAS Number | 657-24-9 |
Molecular Formula | C4H11N5 |
Purity | ≥95% |
Storage | 3 years -20C powder |
IUPAC Name | 3-(diaminomethylidene)-1,1-dimethylguanidine |
InChI | InChI=1S/C4H11N5/c1-9(2)4(7)8-3(5)6/h1-2H3,(H5,5,6,7,8) |
InChIKey | XZWYZXLIPXDOLR-UHFFFAOYSA-N |
SMILES | CN(C)C(=N)N=C(N)N |