For research use only. Not for therapeutic Use.
MAP855（Cat No.:I043857）is a selective inhibitor of the enzyme mitogen-activated protein kinase (MAPK) kinase, a key player in various cellular processes including growth, differentiation, and stress response. By targeting this pathway, MAP855 shows promise in regulating abnormal cell signaling associated with cancer and inflammatory diseases. Its inhibition of MAPK signaling has demonstrated potential in preclinical studies to suppress tumor growth and metastasis, making it a promising candidate for cancer therapy. Additionally, MAP855’s anti-inflammatory properties offer potential for treating autoimmune and other chronic inflammatory conditions.
| CAS Number | 1660107-77-6 |
| Synonyms | 1-[(3S,4S)-4-[8-(2-chloro-4-pyrimidin-2-yloxyphenyl)-7-fluoro-2-methylimidazo[4,5-c]quinolin-1-yl]-3-fluoropiperidin-1-yl]-2-hydroxyethanone |
| Molecular Formula | C28H23ClF2N6O3 |
| Purity | ≥95% |
| IUPAC Name | 1-[(3S,4S)-4-[8-(2-chloro-4-pyrimidin-2-yloxyphenyl)-7-fluoro-2-methylimidazo[4,5-c]quinolin-1-yl]-3-fluoropiperidin-1-yl]-2-hydroxyethanone |
| InChI | InChI=1S/C28H23ClF2N6O3/c1-15-35-24-12-34-23-11-21(30)18(17-4-3-16(9-20(17)29)40-28-32-6-2-7-33-28)10-19(23)27(24)37(15)25-5-8-36(13-22(25)31)26(39)14-38/h2-4,6-7,9-12,22,25,38H,5,8,13-14H2,1H3/t22-,25-/m0/s1 |
| InChIKey | WZZBNLYBHUDSHF-DHLKQENFSA-N |
| SMILES | CC1=NC2=C(N1C3CCN(CC3F)C(=O)CO)C4=CC(=C(C=C4N=C2)F)C5=C(C=C(C=C5)OC6=NC=CC=N6)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
