For research use only. Not for therapeutic Use.
Mandestrobin(CAT: I031489) is a broad-spectrum strobilurin fungicide used to protect crops from various fungal diseases. It functions by inhibiting mitochondrial respiration in fungal cells through the blockade of the cytochrome bc1 complex (complex III) in the electron transport chain. This inhibition disrupts ATP production, leading to energy depletion and the eventual death of the fungal pathogen. Mandestrobin is particularly effective against diseases like powdery mildew, gray mold, and anthracnose in crops such as grapes, apples, and strawberries. Its preventive and curative properties make it a valuable tool in agriculture for managing fungal infections and improving crop yield.
CAS Number | 173662-97-0 |
Synonyms | Mandestrobin; S 2200; S2200; S-2200 |
Molecular Formula | C19H23NO3 |
Purity | 98% |
Documentation | |
Solubility | To be determined |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | Benzeneacetamide, 2-((2,5-dimethylphenoxy)methyl)-alpha-methoxy-N-methyl- |
InChI | InChI=1S/C19H23NO3/c1-13-9-10-14(2)17(11-13)23-12-15-7-5-6-8-16(15)18(22-4)19(21)20-3/h5-11,18H,12H2,1-4H3,(H,20,21) |
InChIKey | PDPWCKVFIFAQIQ-UHFFFAOYSA-N |
SMILES | CNC(=O)C(OC)c1ccccc1COc2cc(C)ccc2C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |