Mandelic acid(CAT: R022881) is an aromatic alpha hydroxy acid (AHA) with a benzene ring and a hydroxy group on the adjacent carbon. Its mode of action involves being used in various skincare products due to its exfoliating and skin-rejuvenating properties. Mandelic acid has a larger molecular size compared to other AHAs like glycolic acid, making it milder and less irritating to the skin. It is commonly used in chemical peels, acne treatments, and anti-aging formulations to improve skin texture, treat hyperpigmentation, and reduce the appearance of fine lines and wrinkles.
| Catalog Number | R022881 |
| CAS Number | 90-64-2 |
| Synonyms | α-Hydroxy-Benzeneacetic acid; (RS)-2-Hydroxy-2-phenylacetic Acid; (RS)-Mandelic Acid; (±)-2-Hydroxy-2-phenylethanoic Acid; (±)-Mandelic Acid; (±)-α-Hydroxybenzeneacetic Acid; (±)-α-Hydroxyphenylacetic Acid; 2-Hydroxy-2-phenylacetic Acid; 2-Phenyl-2-h |
| Molecular Formula | C8H8O3 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | 2-hydroxy-2-phenylacetic acid |
| InChI | InChI=1S/C8H8O3/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7,9H,(H,10,11) |
| InChIKey | IWYDHOAUDWTVEP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)O |
