For research use only. Not for therapeutic Use.
Maduramicin(Cat No.:R009580)is a potent ionophore antibiotic primarily used in veterinary medicine to control coccidiosis, a parasitic disease affecting poultry and livestock. As a polyether compound, Maduramicin disrupts ion balance in target protozoa, leading to their rapid death. Its high efficacy at low doses makes it a valuable tool in animal husbandry for maintaining flock health and preventing disease spread. Additionally, Maduramicin’s distinct mode of action has drawn interest in pharmacological research, particularly for its role in studying ion transport and potential resistance mechanisms among protozoan pathogens.
| CAS Number | 84878-61-5 |
| Synonyms | Cygro; Maduramicin Ammonium; Maduramycin Ammonium; Maduramicin α, Monoammonium Salt; Prinicin Ammonium; CL 259971; |
| Molecular Formula | C47H83NO17 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | Store at -20°C |
| IUPAC Name | azane;2-[(2R,3S,4S,5R,6S)-6-[(1R)-1-[(2S,5R,7S,8R,9S)-2-[(2R,5S)-5-[(2R,3S,5R)-3-[(2R,4S,5S,6S)-4,5-dimethoxy-6-methyloxan-2-yl]oxy-5-[(2S,3S,5R,6S)-6-hydroxy-3,5,6-trimethyloxan-2-yl]oxolan-2-yl]-5-methyloxolan-2-yl]-7-hydroxy-2,8-dimethyl-1,10-dioxaspiro[4.5]decan-9-yl]ethyl]-2-hydroxy-4,5-dimethoxy-3-methyloxan-2-yl]acetic acid |
| InChI | InChI=1S/C47H80O17.H3N/c1-23-18-24(2)45(9,51)61-36(23)31-19-32(58-35-20-30(53-10)40(55-12)28(6)57-35)42(59-31)44(8)15-14-33(60-44)43(7)16-17-46(64-43)21-29(48)25(3)37(62-46)26(4)38-41(56-13)39(54-11)27(5)47(52,63-38)22-34(49)50;/h23-33,35-42,48,51-52H,14-22H2,1-13H3,(H,49,50);1H3/t23-,24+,25+,26+,27-,28-,29-,30-,31+,32-,33+,35+,36-,37-,38-,39-,40-,41-,42+,43-,44-,45-,46+,47+;/m0./s1 |
| InChIKey | WQGJEAMPBSZCIF-HKSLRPGUSA-N |
| SMILES | C[C@H]1C[C@H]([C@@](O[C@@H]1[C@H]2C[C@@H]([C@@H](O2)[C@@]3(CC[C@@H](O3)[C@@]4(CC[C@@]5(O4)C[C@@H]([C@H]([C@H](O5)[C@@H](C)[C@H]6[C@@H]([C@H]([C@@H]([C@](O6)(CC(=O)O)O)C)OC)OC)C)O)C)C)O[C@@H]7C[C@@H]([C@H]([C@@H](O7)C)OC)OC)(C)O)C.N |
| Reference | Novel polyether antibiotics X-14868A, B, C, and D produced by a Nocardia. Discovery, fermentation, biological as well as ionophore properties and taxonomy of the producing culture. Liu C.M. et al. J. Antibiot. 1983, 36, 343.</span></p> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |