For research use only. Not for therapeutic Use.
Lirinidine（Cat No.:I012509）is an aporphine alkaloid isolated from plants in the Nymphaeaceae family, particularly Nymphaea caerulea (blue lotus). It exhibits a range of pharmacological activities, including antispasmodic, vasodilatory, and potential neuroactive effects. Lirinidine acts on smooth muscle and may influence neurotransmitter systems, making it of interest for neurological and cardiovascular research. Its structural similarity to other aporphine alkaloids suggests possible dopaminergic or serotonergic interactions. Although less extensively studied than related compounds, lirinidine holds promise for further exploration as a natural therapeutic agent targeting mood regulation, vascular tone, and smooth muscle-related disorders.
| CAS Number | 54383-28-7 |
| Synonyms | (6aS)-2-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol |
| Molecular Formula | C18H19NO2 |
| Purity | ≥95% |
| IUPAC Name | (6aS)-2-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol |
| InChI | InChI=1S/C18H19NO2/c1-19-8-7-12-10-15(21-2)18(20)17-13-6-4-3-5-11(13)9-14(19)16(12)17/h3-6,10,14,20H,7-9H2,1-2H3/t14-/m0/s1 |
| InChIKey | YXVXMURDCBMPRH-AWEZNQCLSA-N |
| SMILES | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=CC=CC=C43)O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
