For research use only. Not for therapeutic Use.
L-Xylose(CAT: R025451) is a rare pentose monosaccharide and the enantiomer of the more common D-xylose. As a five-carbon sugar, L-Xylose serves as a valuable biochemical reagent and synthetic building block in carbohydrate chemistry and glycobiology research. It is used in the preparation of glycosides, oligosaccharides, and glycoconjugates, supporting studies of carbohydrate-protein interactions, enzymatic specificity, and metabolic pathways. L-Xylose is also applied in the development of novel biomaterials, diagnostics, and therapeutic agents. Its unique stereochemistry makes it an important tool for exploring rare sugar functions and for the synthesis of stereochemically defined carbohydrate derivatives in chemical biology and medicinal chemistry.
| CAS Number | 609-06-3 |
| Synonyms | (2S,3R,4S)-2,3,4,5-tetrahydroxypentanal |
| Molecular Formula | C5H10O5 |
| Purity | ≥95% |
| IUPAC Name | (2S,3R,4S)-2,3,4,5-tetrahydroxypentanal |
| InChI | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4+,5+/m1/s1 |
| InChIKey | PYMYPHUHKUWMLA-WISUUJSJSA-N |
| SMILES | C(C(C(C(C=O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
