L-Tryptophan-d3(Cat No.:C000353) is a high-purity, deuterium-labeled compound essential for advanced pharmaceutical and biochemical research. Featuring three deuterium atoms, this isotopically labeled version of L-Tryptophan is crucial for studies on protein synthesis, metabolic pathways, and neurotransmitter research. L-Tryptophan-d3 aids in the development of therapeutic agents and enhances the understanding of metabolic processes and biochemical mechanisms, making it a valuable tool for scientific investigations and drug development.
Catalog Number | C000353 |
CAS Number | 133519-78-5 |
Synonyms | (+/-)-Tryptophan-d3; (-)-1H-Indole-3-alanine-d3; L-α-Amino-3-indolepropionic Acid-d3; NSC 13119-d3; l-α-Aminoindole-3-propionic Acid-d3; |
Molecular Formula | C₁₁H₉D₃N₂O₂ |
Purity | ≥95% |
Solubility | Aqueous Acid (Slightly), Methanol (Very Slightly), Water (Slightly) |
Appearance | White to Pale Yellow Solid |
Storage | -20°C |
IUPAC Name | (2S)-2-amino-2,3,3-trideuterio-3-(1H-indol-3-yl)propanoic acid |
InChI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1/i5D2,9D |
InChIKey | QIVBCDIJIAJPQS-PKHUVNBJSA-N |
SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])C1=CNC2=CC=CC=C21)N |