N-Acetyl Glyphosate-13C2,15N is an isotopically labeled derivative of N-acetyl glyphosate, used as a reference standard in analytical chemistry. This compound incorporates carbon-13 and nitrogen-15 isotopes, enabling precise tracking and quantification in environmental and biochemical studies. It is valuable in researching the metabolic pathways and environmental fate of glyphosate-based herbicides. The isotopic labeling aids in mass spectrometry and other analytical techniques, enhancing the accuracy and sensitivity of detection in complex matrices.
| Catalog Number | R052712 |
| CAS Number | 1346598-31-9 |
| Synonyms | N-Acetyl-N-(phosphonomethyl)glycine-13C2,15N; N-Acetylglyphosate-13C2,15N; |
| Molecular Formula | 13C2 C3 H10 15N O6 P |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | 2-[acetyl(phosphonomethyl)amino]acetic acid |
| InChI | InChI=1S/C5H10NO6P/c1-4(7)6(2-5(8)9)3-13(10,11)12/h2-3H2,1H3,(H,8,9)(H2,10,11,12)/i2+1,5+1,6+1 |
| InChIKey | BFECXRMSKVFCNB-OEKWKHNNSA-N |
| SMILES | CC(=O)N(CC(=O)O)CP(=O)(O)O |
