For research use only. Not for therapeutic Use.
L-m-Tyrosine（Cat No.:R008437）is a positional isomer of the amino acid L-tyrosine, distinguished by the placement of the hydroxyl group on the meta position of the phenyl ring. As a non-proteinogenic amino acid, it is primarily used in biochemical and pharmacological research to study structural variations in aromatic amino acids and their impact on enzyme recognition, transport, and metabolism. Researchers employ L-m-Tyrosine in metabolic and neurochemical studies to explore catecholamine biosynthesis, receptor interactions, and amino acid analog activity. Its unique structure makes it useful in neurological and metabolic investigations.
| CAS Number | 587-33-7 |
| Synonyms | (2S)-2-amino-3-(3-hydroxyphenyl)propanoic acid |
| Molecular Formula | C9H11NO3 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-amino-3-(3-hydroxyphenyl)propanoic acid |
| InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-2-1-3-7(11)4-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | JZKXXXDKRQWDET-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC(=C1)O)C[C@@H](C(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
