For research use only. Not for therapeutic Use.
KB-5492 free base（Cat No.:I043296）is an experimental small molecule inhibitor being developed for the treatment of various cancers. It targets specific signaling pathways involved in tumor growth and progression, with a focus on inhibiting protein synthesis and cellular proliferation. As the free base form of the compound, KB-5492 does not contain any salts or additional chemical modifications, allowing for studies on its stability, bioavailability, and pharmacokinetics. It is currently under investigation in clinical trials to evaluate its safety and efficacy as part of targeted cancer therapies.
| CAS Number | 113594-64-2 |
| Synonyms | (4-methoxyphenyl) 2-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]acetate |
| Molecular Formula | C23H30N2O6 |
| Purity | ≥95% |
| IUPAC Name | (4-methoxyphenyl) 2-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]acetate |
| InChI | InChI=1S/C23H30N2O6/c1-27-18-5-7-19(8-6-18)31-22(26)16-25-11-9-24(10-12-25)15-17-13-20(28-2)23(30-4)21(14-17)29-3/h5-8,13-14H,9-12,15-16H2,1-4H3 |
| InChIKey | RVYZAZTXLLAVGZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OC(=O)CN2CCN(CC2)CC3=CC(=C(C(=C3)OC)OC)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
