For research use only. Not for therapeutic Use.
IT-901（Cat No.:I007389）is a small-molecule inhibitor that selectively targets the transcription factor NF-κB (nuclear factor kappa-light-chain-enhancer of activated B cells), a master regulator of genes involved in inflammation, immunity, and cancer progression. By suppressing NF-κB signaling, IT-901 reduces the expression of pro-inflammatory cytokines, survival proteins, and oncogenic factors, leading to impaired tumor cell growth and enhanced apoptosis. It has been investigated in hematologic malignancies and solid tumors as a potential therapeutic strategy. IT-901 is widely used in cancer biology, immunology, and drug discovery research to probe NF-κB–dependent pathways.
| CAS Number | 1584121-99-2 |
| Synonyms | 5-[(2,4-dimethoxynaphthalen-1-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| Molecular Formula | C17H14N2O4S |
| Purity | ≥95% |
| IUPAC Name | 5-[(2,4-dimethoxynaphthalen-1-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| InChI | InChI=1S/C17H14N2O4S/c1-22-13-8-14(23-2)11(9-5-3-4-6-10(9)13)7-12-15(20)18-17(24)19-16(12)21/h3-8H,1-2H3,(H2,18,19,20,21,24) |
| InChIKey | JHOPCCOYRKEHQU-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C2=CC=CC=C21)C=C3C(=O)NC(=S)NC3=O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
