For research use only. Not for therapeutic Use.
Isoeugenol（Cat No.:R070659）is a natural phenolic compound found in essential oils of plants like clove and nutmeg, known for its distinctive aroma and various bioactive properties. It possesses strong antioxidant, anti-inflammatory, and antimicrobial effects, making it valuable in both food preservation and cosmetics. Isoeugenol is also studied for its potential in pain relief and as an anti-cancer agent due to its ability to inhibit cell proliferation. Widely used in the fragrance and flavor industries, Isoeugenol is a versatile compound that contributes to health, wellness, and product formulations across multiple sectors.
| CAS Number | 97-54-1 |
| Synonyms | 2-Methoxy-4-propenylphenol |
| Molecular Formula | C10H12O2 |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | -20°C |
| IUPAC Name | 2-methoxy-4-[(E)-prop-1-enyl]phenol |
| InChI | InChI=1S/C10H12O2/c1-3-4-8-5-6-9(11)10(7-8)12-2/h3-7,11H,1-2H3/b4-3+ |
| InChIKey | BJIOGJUNALELMI-ONEGZZNKSA-N |
| SMILES | C/C=C/C1=CC(=C(C=C1)O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
