For research use only. Not for therapeutic Use.
Isobutyl-deoxynyboquinone (Cat No.:I044357) is a synthetic quinone-based compound engineered as a potent anticancer agent through bioactivation by the enzyme NAD(P)H:quinone oxidoreductase 1 (NQO1), which is overexpressed in many tumors. Upon enzymatic reduction, IB-DNQ undergoes redox cycling, generating high levels of reactive oxygen species (ROS) that induce oxidative DNA damage and cell death selectively in NQO1-positive cancer cells. Its mechanism exploits tumor-specific vulnerabilities while sparing normal tissues. Preclinical studies have shown strong efficacy against solid tumors, positioning IB-DNQ as a promising candidate for targeted oxidative chemotherapy with a favorable therapeutic index.
| CAS Number | 1430798-22-3 |
| Synonyms | 4,6-dimethyl-1-(2-methylpropyl)-9H-pyrido[3,2-g]quinoline-2,5,8,10-tetrone |
| Molecular Formula | C18H18N2O4 |
| Purity | ≥95% |
| IUPAC Name | 4,6-dimethyl-1-(2-methylpropyl)-9H-pyrido[3,2-g]quinoline-2,5,8,10-tetrone |
| InChI | InChI=1S/C18H18N2O4/c1-8(2)7-20-12(22)6-10(4)14-16(20)18(24)15-13(17(14)23)9(3)5-11(21)19-15/h5-6,8H,7H2,1-4H3,(H,19,21) |
| InChIKey | XVXDZGBARWYTHG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC2=C1C(=O)C3=C(C2=O)N(C(=O)C=C3C)CC(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
