Isoastilbin (Cat No.:R044987) is a flavonoid compound commonly found in certain plant sources. It is a glycoside derivative of astilbin, and its structure consists of a flavonoid aglycone attached to a sugar moiety. Isoastilbin is known for its potential bioactivities, including antioxidant, anti-inflammatory, and antitumor properties. It has been studied for its potential health benefits and may have therapeutic applications in various conditions.
| Catalog Number | R044987 |
| CAS Number | 54081-48-0 |
| Molecular Formula | C21H22O11 |
| Purity | ≥95% |
| Storage | 2-8°C(protect from light) |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C21H22O11/c1-7-15(26)17(28)18(29)21(30-7)32-20-16(27)14-12(25)5-9(22)6-13(14)31-19(20)8-2-3-10(23)11(24)4-8/h2-7,15,17-26,28-29H,1H3 |
| InChIKey | ZROGCCBNZBKLEL-UHFFFAOYSA-N |
| SMILES | CC1C(C(C(C(O1)OC2C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C=C4)O)O)O)O)O |
