For research use only. Not for therapeutic Use.
Indole-d7(Cat No.:I041517)is a deuterated form of indole, where seven hydrogen atoms are replaced by the stable isotope deuterium (2H). This modification makes indole-d7 useful in isotopic labeling studies, enabling researchers to trace the molecule’s movement and behavior in various chemical and biological processes. It is often employed in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy to study metabolic pathways, drug interactions, or biosynthesis. The use of deuterated indole-d7 enhances the precision of experiments by providing distinct signals, allowing scientists to better understand molecular mechanisms and reactions.
CAS Number | 73509-20-3 |
Synonyms | 1,2,3,4,5,6,7-heptadeuterioindole |
Molecular Formula | C8D7N |
Purity | ≥95% |
IUPAC Name | 1,2,3,4,5,6,7-heptadeuterioindole |
InChI | InChI=1S/C8H7N/c1-2-4-8-7(3-1)5-6-9-8/h1-6,9H/i1D,2D,3D,4D,5D,6D/hD |
InChIKey | SIKJAQJRHWYJAI-HOSXNMPPSA-N |
SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2[2H])[2H])[2H])[2H])[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |