For research use only. Not for therapeutic Use.
Hydralazine Hydrochloride(CAT: A000980) is a direct-acting vasodilator widely studied in cardiovascular research. By relaxing vascular smooth muscle, it reduces peripheral resistance and improves arterial blood flow, making it a key compound for investigating hypertension and heart failure. Hydralazine’s mechanism involves modulation of intracellular calcium metabolism, and it has been used to explore oxidative stress pathways, endothelial function, and vascular remodeling. Beyond its antihypertensive effects, Hydralazine Hydrochloride is also studied for its role in epigenetics, particularly as a DNA demethylating agent with potential applications in cancer research.
| CAS Number | 304-20-1 |
| Synonyms | 304-20-1; 1-Hydrazinophthalazine hydrochloride; 1-Hydrazinylphthalazine hydrochloride; Apresoline; Aiselazine |
| Molecular Formula | C8H9ClN4 |
| Purity | ≥95% |
| Target | Bcl-2 Family |
| Storage | -20°C |
| IUPAC Name | phthalazin-1-ylhydrazine;hydrochloride |
| InChI | 1S/C8H8N4.ClH/c9-11-8-7-4-2-1-3-6(7)5-10-12-8;/h1-5H,9H2,(H,11,12);1H |
| InChIKey | ZUXNZUWOTSUBMN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NN=C2NN.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
