For research use only. Not for therapeutic Use.
Guaijaverin(Cat No.:R031406)is a natural flavonoid glycoside found in plants like Psidium guajava (guava), known for its potent antioxidant, anti-inflammatory, and antimicrobial properties. It is particularly valued for its dental health benefits, as studies suggest it inhibits the growth of Streptococcus mutans, a primary bacterium involved in dental caries. Additionally, guaijaverin demonstrates potential in protecting cells against oxidative stress, supporting cardiovascular health, and modulating immune responses. Due to these therapeutic effects, it is explored in natural medicine and pharmacology for developing health-promoting formulations.
| CAS Number | 22255-13-6 |
| Molecular Formula | C20H18O11 |
| Purity | ≥95% |
| Target | Bacterial |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxychromen-4-one |
| InChI | InChI=1S/C20H18O11/c21-8-4-11(24)14-13(5-8)30-18(7-1-2-9(22)10(23)3-7)19(16(14)27)31-20-17(28)15(26)12(25)6-29-20/h1-5,12,15,17,20-26,28H,6H2/t12-,15-,17+,20-/m0/s1 |
| InChIKey | PZZRDJXEMZMZFD-IEGSVRCHSA-N |
| SMILES | C1[C@@H]([C@@H]([C@H]([C@@H](O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C=C4)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |