For research use only. Not for therapeutic Use.
GPR139 Agonist-2(CAT: I040609) is a selective small-molecule agonist targeting G protein-coupled receptor 139 (GPR139), an orphan receptor predominantly expressed in the brain, particularly in the hypothalamus and pituitary. This compound is instrumental in elucidating the physiological roles of GPR139, which is implicated in neuroendocrine regulation, appetite control, mood modulation, and potentially in neuropsychiatric and metabolic disorders. GPR139 Agonist-2 enables in-depth pharmacological and signaling pathway studies, offering insights into receptor activation, downstream signaling, and potential therapeutic applications. Its specificity and efficacy make it a valuable tool in CNS drug discovery and receptor characterization.
| CAS Number | 2983118-29-0 |
| Synonyms | 2-(4-oxopyrrolo[1,2-d][1,2,4]triazin-3-yl)-N-[(1S)-1-[4-(trifluoromethoxy)phenyl]ethyl]acetamide |
| Molecular Formula | C17H15F3N4O3 |
| Purity | ≥95% |
| IUPAC Name | 2-(4-oxopyrrolo[1,2-d][1,2,4]triazin-3-yl)-N-[(1S)-1-[4-(trifluoromethoxy)phenyl]ethyl]acetamide |
| InChI | InChI=1S/C17H15F3N4O3/c1-11(12-4-6-14(7-5-12)27-17(18,19)20)22-15(25)10-24-16(26)23-8-2-3-13(23)9-21-24/h2-9,11H,10H2,1H3,(H,22,25)/t11-/m0/s1 |
| InChIKey | QCGDQGNBYQRDAB-NSHDSACASA-N |
| SMILES | CC(C1=CC=C(C=C1)OC(F)(F)F)NC(=O)CN2C(=O)N3C=CC=C3C=N2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
