Gonyautoxin-4 (Cat No.:T000009) is a neurotoxin produced by certain algae species, including Alexandrium and Gymnodinium. It is classified as a saxitoxin and can cause paralytic shellfish poisoning (PSP) in humans. GTX-4 acts by blocking sodium channels in nerve cells, leading to symptoms such as tingling, numbness, and paralysis if consumed. It is monitored in shellfish and other seafood to prevent PSP outbreaks, as the toxin can accumulate in these organisms.
Catalog Number | T000009 |
CAS Number | 64296-26-0 |
Synonyms | Gonyautoxin 4; Toxin GTX4 |
Molecular Formula | C10H17N7O9S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [(3aS,4R,9S,10aS)-2-amino-5,10,10-trihydroxy-6-imino-9-sulfooxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate |
InChI | InChI=1S/C10H17N7O9S/c11-6-14-5-3(2-25-8(13)18)17(21)7(12)16-1-4(26-27(22,23)24)10(19,20)9(5,16)15-6/h3-5,12,19-21H,1-2H2,(H2,13,18)(H3,11,14,15)(H,22,23,24)/t3-,4-,5-,9-/m0/s1 |
InChIKey | CETRDCWBMBILAL-LJRZAWCWSA-N |
SMILES | C1C(C(C23N1C(=N)N(C(C2N=C(N3)N)COC(=O)N)O)(O)O)OS(=O)(=O)O |