For research use only. Not for therapeutic Use.
GLP-1R agonist 12（Cat No.:I043509）is a novel therapeutic compound designed to activate the glucagon-like peptide-1 receptor (GLP-1R), which plays a crucial role in regulating insulin secretion, glucose homeostasis, and appetite. By mimicking the natural GLP-1 hormone, it enhances insulin release in response to meals, suppresses glucagon secretion, and slows gastric emptying, ultimately helping to lower blood sugar levels. GLP-1R agonist 12 is being investigated for its potential to treat type 2 diabetes and obesity, offering an alternative or improvement over existing GLP-1R agonists with potentially enhanced efficacy or longer duration of action.
| CAS Number | 2765595-19-3 |
| Synonyms | 2-[[4-[6-[(2-cyclopropylpyrazolo[1,5-a]pyridin-6-yl)methoxy]pyridin-2-yl]piperidin-1-yl]methyl]-3-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylic acid |
| Molecular Formula | C34H36N6O4 |
| Purity | ≥95% |
| IUPAC Name | 2-[[4-[6-[(2-cyclopropylpyrazolo[1,5-a]pyridin-6-yl)methoxy]pyridin-2-yl]piperidin-1-yl]methyl]-3-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylic acid |
| InChI | InChI=1S/C34H36N6O4/c41-34(42)25-7-9-29-31(16-25)39(19-27-12-15-43-27)32(35-29)20-38-13-10-24(11-14-38)28-2-1-3-33(36-28)44-21-22-4-8-26-17-30(23-5-6-23)37-40(26)18-22/h1-4,7-9,16-18,23-24,27H,5-6,10-15,19-21H2,(H,41,42)/t27-/m0/s1 |
| InChIKey | TUSYJBRBOOOKPJ-MHZLTWQESA-N |
| SMILES | C1CO[C@@H]1CN2C3=C(C=CC(=C3)C(=O)O)N=C2CN4CCC(CC4)C5=NC(=CC=C5)OCC6=CN7C(=CC(=N7)C8CC8)C=C6 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
