For research use only. Not for therapeutic Use.
Girodazole(Cat No.:M110178) is a synthetic chemical compound primarily researched for its potential applications in pharmaceuticals and agriculture. It belongs to a class of molecules known for their biological activity, including anti-inflammatory and antimicrobial properties. Girodazole has been the subject of studies aiming to exploit these properties to treat various diseases and pests. Its molecular structure allows for interaction with specific biological pathways, potentially leading to the development of new drugs or pesticides.
CAS Number | 135824-74-7 |
Synonyms | girodazole |
Molecular Formula | C6H13Cl3N4O |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | (1S,2S)-3-amino-1-(2-amino-1H-imidazol-5-yl)-2-chloropropan-1-ol;dihydrochloride |
InChI | InChI=1S/C6H11ClN4O.2ClH/c7-3(1-8)5(12)4-2-10-6(9)11-4;;/h2-3,5,12H,1,8H2,(H3,9,10,11);2*1H/t3-,5+;;/m0../s1 |
InChIKey | TUMTXKWKOVMCSV-BZNGOSNWSA-N |
SMILES | C1=C(NC(=N1)N)C(C(CN)Cl)O.Cl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |