Desmethyl-DPA-713 is a metabolite of DPA-713, retaining affinity for the translocator protein (TSPO), making it useful in neuroinflammation research. This compound is often studied to understand the metabolic pathways and pharmacokinetics of TSPO ligands. Although it exhibits lower binding affinity compared to DPA-713, Desmethyl-DPA-713 provides valuable insights into the in vivo metabolism of neuroimaging agents, contributing to the development of more effective diagnostic tools for neurodegenerative diseases and the assessment of therapeutic interventions.
Catalog Number | R072252 |
CAS Number | 868072-17-7 |
Synonyms | N,N-Diethyl-2-(2-(4-hydroxyphenyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)-acetamide |
Molecular Formula | C21H26N4O2 |
Purity | ≥95% |
InChI | 1S/C20H24N4O2/c1-5-23(6-2)18(26)12-17-19(15-7-9-16(25)10-8-15)22-24-14(4)11-13(3)21-20(17)24/h7-11,25H,5-6,12H2,1-4H3 |
InChIKey | XNPWVZZOTNFVLY-UHFFFAOYSA-N |
SMILES | CCN(CC)C(=O)CC1=C2N=C(C=C(N2N=C1C3=CC=C(C=C3)O)C)C |