For research use only. Not for therapeutic Use.
Ganoderic acid E（Cat No.:I044966）is a bioactive triterpenoid compound derived from the fruiting body of Ganoderma lucidum, a well-known medicinal mushroom. It exhibits multiple pharmacological effects, including anti-inflammatory, hepatoprotective, antioxidant, and anticancer activities. Ganoderic acid E has been shown to inhibit tumor cell proliferation, suppress metastasis, and modulate immune responses. It is frequently studied for its potential therapeutic roles in liver disorders, cancer, and metabolic diseases. As part of the ganoderic acid family, it contributes to the adaptogenic and restorative effects of G. lucidum. Supplied for research use in pharmacological and biomedical studies.
| CAS Number | 98665-14-6 |
| Synonyms | (2R,6R)-2-methyl-4-oxo-6-[(5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-3,7,11,15-tetraoxo-2,5,6,12,16,17-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid |
| Molecular Formula | C30H40O7 |
| Purity | ≥95% |
| IUPAC Name | (2R,6R)-2-methyl-4-oxo-6-[(5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-3,7,11,15-tetraoxo-2,5,6,12,16,17-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid |
| InChI | InChI=1S/C30H40O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h15-16,18,21H,8-14H2,1-7H3,(H,36,37)/t15-,16-,18-,21+,28+,29-,30+/m1/s1 |
| InChIKey | VBGDQDJVTLQGNO-JXLWEQSJSA-N |
| SMILES | C[C@H](CC(=O)C[C@@H](C)C(=O)O)[C@H]1CC(=O)[C@@]2([C@@]1(CC(=O)C3=C2C(=O)C[C@@H]4[C@@]3(CCC(=O)C4(C)C)C)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
