For research use only. Not for therapeutic Use.
Furobufen（Cat No.:I015446）is a nonsteroidal anti-inflammatory drug (NSAID) belonging to the arylpropionic acid class, structurally related to ibuprofen. It functions primarily as a cyclooxygenase (COX) inhibitor, reducing prostaglandin synthesis that drives inflammation, pain, and fever. Investigated for its analgesic, anti-inflammatory, and antipyretic properties, Furobufen has been studied in models of rheumatoid arthritis, osteoarthritis, and other inflammatory conditions. While not widely marketed, it serves as a pharmacological reference compound for understanding NSAID mechanisms and evaluating structure–activity relationships in anti-inflammatory drug development and therapeutic research.
| CAS Number | 38873-55-1 |
| Synonyms | 4-dibenzofuran-2-yl-4-oxobutanoic acid |
| Molecular Formula | C16H12O4 |
| Purity | ≥95% |
| IUPAC Name | 4-dibenzofuran-2-yl-4-oxobutanoic acid |
| InChI | InChI=1S/C16H12O4/c17-13(6-8-16(18)19)10-5-7-15-12(9-10)11-3-1-2-4-14(11)20-15/h1-5,7,9H,6,8H2,(H,18,19) |
| InChIKey | LQVMQEYROPXMQH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC(=C3)C(=O)CCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
