For research use only. Not for therapeutic Use.
FSEN1 (Cat No.:I041133) is an enzyme involved in the process of glycosylation, specifically fucosylation, which adds fucose sugars to proteins and lipids. This modification plays a significant role in cell signaling, adhesion, and immune responses. FSEN1 is implicated in various biological processes, including cancer metastasis, immune modulation, and cellular interactions. Dysregulation of FSEN1 has been associated with several diseases, making it a potential target for therapeutic intervention. Researchers are exploring FSEN1 inhibitors to modulate fucosylation and provide new treatment strategies for cancer and other conditions influenced by glycosylation.
| CAS Number | 862808-01-3 |
| Synonyms | 3-(4-bromophenyl)-6-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-[1,3]thiazolo[2,3-c][1,2,4]triazole |
| Molecular Formula | C22H22BrN5OS |
| Purity | ≥95% |
| IUPAC Name | 3-(4-bromophenyl)-6-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-[1,3]thiazolo[2,3-c][1,2,4]triazole |
| InChI | InChI=1S/C22H22BrN5OS/c1-29-19-8-6-18(7-9-19)27-12-10-26(11-13-27)14-20-15-28-21(24-25-22(28)30-20)16-2-4-17(23)5-3-16/h2-9,15H,10-14H2,1H3 |
| InChIKey | JGXIXBKKDUNARN-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2CCN(CC2)CC3=CN4C(=NN=C4S3)C5=CC=C(C=C5)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
